C21H23NO4S2 — CID 3157410
N-[4-(4-butanoyl-3-oxo-5-thiophen-2-ylcyclohexen-1-yl)phenyl]methanesulfonamide (PubChem CID 3157410) has the molecular formula C21H23NO4S2 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[4-(4-butanoyl-3-oxo-5-thiophen-2-ylcyclohexen-1-yl)phenyl]methanesulfonamide.
| Compound Name | N-[4-(4-butanoyl-3-oxo-5-thiophen-2-ylcyclohexen-1-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 3157410 |
| Molecular Formula | C21H23NO4S2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | N-[4-(4-butanoyl-3-oxo-5-thiophen-2-ylcyclohexen-1-yl)phenyl]methanesulfonamide |
| SMILES | CCCC(=O)C1C(=O)C=C(c2ccc(NS(C)(=O)=O)cc2)CC1c1cccs1 |
| InChI | InChI=1S/C21H23NO4S2/c1-3-5-18(23)21-17(20-6-4-11-27-20)12-15(13-19(21)24)14-7-9-16(10-8-14)22-28(2,25)26/h4,6-11,13,17,21-22H,3,5,12H2,1-2H3 |
| InChIKey | SDBVXRYSOMHOFK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|