2-imidazo[2,1-b][1,3]thiazol-6-ylacetic acid

C7H6N2O2S — CID 3157493

IUPAC2-imidazo[2,1-b][1,3]thiazol-6-ylacetic acid
SMILESO=C(O)Cc1cn2ccsc2n1
InChIInChI=1S/C7H6N2O2S/c10-6(11)3-5-4-9-1-2-12-7(9)8-5/h1-2,4H,3H2,(H,10,11)
InChIKeyFQIBVYSYFWBQHP-UHFFFAOYSA-N
MW182.20 g/mol
LogP1.02
Rot. Bonds2

About 2-imidazo[2,1-b][1,3]thiazol-6-ylacetic acid

2-imidazo[2,1-b][1,3]thiazol-6-ylacetic acid (PubChem CID 3157493) has the molecular formula C7H6N2O2S and a molecular weight of 182.20 g/mol. Its IUPAC name is 2-imidazo[2,1-b][1,3]thiazol-6-ylacetic acid.

Molecular Properties

Compound Name2-imidazo[2,1-b][1,3]thiazol-6-ylacetic acid
PubChem CID3157493
Molecular FormulaC7H6N2O2S
Molecular Weight182.20 g/mol
Exact Mass182.01
IUPAC Name2-imidazo[2,1-b][1,3]thiazol-6-ylacetic acid
SMILESO=C(O)Cc1cn2ccsc2n1
InChIInChI=1S/C7H6N2O2S/c10-6(11)3-5-4-9-1-2-12-7(9)8-5/h1-2,4H,3H2,(H,10,11)
InChIKeyFQIBVYSYFWBQHP-UHFFFAOYSA-N
XLogP1.02
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.20
LogP ≤ 51.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-imidazo[2,1-b][1,3]thiazol-6-ylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-imidazo[2,1-b][1,3]thiazol-6-ylacetic acid?
The IUPAC name of 2-imidazo[2,1-b][1,3]thiazol-6-ylacetic acid (CID 3157493) is 2-imidazo[2,1-b][1,3]thiazol-6-ylacetic acid.
What is the SMILES notation for 2-imidazo[2,1-b][1,3]thiazol-6-ylacetic acid?
The canonical SMILES for 2-imidazo[2,1-b][1,3]thiazol-6-ylacetic acid is O=C(O)Cc1cn2ccsc2n1.
What is the InChIKey of 2-imidazo[2,1-b][1,3]thiazol-6-ylacetic acid?
The InChIKey is FQIBVYSYFWBQHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2S/c10-6(11)3-5-4-9-1-2-12-7(9)8-5/h1-2,4H,3H2,(H,10,11).
What are the key properties of 2-imidazo[2,1-b][1,3]thiazol-6-ylacetic acid?
2-imidazo[2,1-b][1,3]thiazol-6-ylacetic acid has a molecular weight of 182.20 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazo[2,1-b][1,3]thiazol-6-ylacetic acid is sourced from PubChem (CID 3157493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).