C12H10N2O3S — CID 3157565
2-(3-acetyl-4-hydroxy-5-oxo-2-thiophen-2-yl-2H-pyrrol-1-yl)acetonitrile (PubChem CID 3157565) has the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. Its IUPAC name is 2-(3-acetyl-4-hydroxy-5-oxo-2-thiophen-2-yl-2H-pyrrol-1-yl)acetonitrile.
| Compound Name | 2-(3-acetyl-4-hydroxy-5-oxo-2-thiophen-2-yl-2H-pyrrol-1-yl)acetonitrile |
|---|---|
| PubChem CID | 3157565 |
| Molecular Formula | C12H10N2O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2-(3-acetyl-4-hydroxy-5-oxo-2-thiophen-2-yl-2H-pyrrol-1-yl)acetonitrile |
| SMILES | CC(=O)C1=C(O)C(=O)N(CC#N)C1c1cccs1 |
| InChI | InChI=1S/C12H10N2O3S/c1-7(15)9-10(8-3-2-6-18-8)14(5-4-13)12(17)11(9)16/h2-3,6,10,16H,5H2,1H3 |
| InChIKey | WBTUVLZNPFPSJF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|