C16H19N3O4S — CID 3157888
N-(1,3-benzodioxol-5-yl)-2-(3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide (PubChem CID 3157888) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide |
|---|---|
| PubChem CID | 3157888 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide |
| SMILES | CC/N=C1/SC(CC(=O)Nc2ccc3c(c2)OCO3)C(=O)N1CC |
| InChI | InChI=1S/C16H19N3O4S/c1-3-17-16-19(4-2)15(21)13(24-16)8-14(20)18-10-5-6-11-12(7-10)23-9-22-11/h5-7,13H,3-4,8-9H2,1-2H3,(H,18,20)/b17-16+ |
| InChIKey | ORCGPFDYBFATGA-WUKNDPDISA-N |
| XLogP | 2.08 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|