About N-(2-methoxyethyl)-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide
N-(2-methoxyethyl)-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide (PubChem CID 3158005) has the molecular formula C12H17N3O4S
and a molecular weight of 299.35 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide |
| PubChem CID | 3158005 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-(2-methoxyethyl)-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc2c(c1)n(C)c(=O)n2C |
| InChI | InChI=1S/C12H17N3O4S/c1-14-10-5-4-9(8-11(10)15(2)12(14)16)20(17,18)13-6-7-19-3/h4-5,8,13H,6-7H2,1-3H3 |
| InChIKey | AUYHCEUIDCPWOU-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide?
The IUPAC name of N-(2-methoxyethyl)-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide (CID 3158005) is N-(2-methoxyethyl)-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide.
What is the SMILES notation for N-(2-methoxyethyl)-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide?
The canonical SMILES for N-(2-methoxyethyl)-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide is COCCNS(=O)(=O)c1ccc2c(c1)n(C)c(=O)n2C.
What is the InChIKey of N-(2-methoxyethyl)-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide?
The InChIKey is AUYHCEUIDCPWOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O4S/c1-14-10-5-4-9(8-11(10)15(2)12(14)16)20(17,18)13-6-7-19-3/h4-5,8,13H,6-7H2,1-3H3.
What are the key properties of N-(2-methoxyethyl)-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide?
N-(2-methoxyethyl)-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide has a molecular weight of 299.35 g/mol, XLogP of -0.20, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide is sourced from PubChem (CID 3158005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).