About (2,6-dimethylpiperidin-1-yl)-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone
(2,6-dimethylpiperidin-1-yl)-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone (PubChem CID 3158164) has the molecular formula C18H22N2O2
and a molecular weight of 298.39 g/mol. Its IUPAC name is (2,6-dimethylpiperidin-1-yl)-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone.
Molecular Properties
| Compound Name | (2,6-dimethylpiperidin-1-yl)-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone |
| PubChem CID | 3158164 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (2,6-dimethylpiperidin-1-yl)-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone |
| SMILES | Cc1ccc(-c2cc(C(=O)N3C(C)CCCC3C)no2)cc1 |
| InChI | InChI=1S/C18H22N2O2/c1-12-7-9-15(10-8-12)17-11-16(19-22-17)18(21)20-13(2)5-4-6-14(20)3/h7-11,13-14H,4-6H2,1-3H3 |
| InChIKey | OPVZKZJOLPZLIC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,6-dimethylpiperidin-1-yl)-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethylpiperidin-1-yl)-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone?
The IUPAC name of (2,6-dimethylpiperidin-1-yl)-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone (CID 3158164) is (2,6-dimethylpiperidin-1-yl)-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone.
What is the SMILES notation for (2,6-dimethylpiperidin-1-yl)-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone?
The canonical SMILES for (2,6-dimethylpiperidin-1-yl)-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone is Cc1ccc(-c2cc(C(=O)N3C(C)CCCC3C)no2)cc1.
What is the InChIKey of (2,6-dimethylpiperidin-1-yl)-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone?
The InChIKey is OPVZKZJOLPZLIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2/c1-12-7-9-15(10-8-12)17-11-16(19-22-17)18(21)20-13(2)5-4-6-14(20)3/h7-11,13-14H,4-6H2,1-3H3.
What are the key properties of (2,6-dimethylpiperidin-1-yl)-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone?
(2,6-dimethylpiperidin-1-yl)-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone has a molecular weight of 298.39 g/mol, XLogP of 4.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethylpiperidin-1-yl)-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone is sourced from PubChem (CID 3158164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).