C21H26N2O4S2 — CID 3158240
2-(2-methoxyethylsulfanyl)-N-(4-piperidin-1-ylsulfonylphenyl)benzamide (PubChem CID 3158240) has the molecular formula C21H26N2O4S2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-(2-methoxyethylsulfanyl)-N-(4-piperidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 2-(2-methoxyethylsulfanyl)-N-(4-piperidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 3158240 |
| Molecular Formula | C21H26N2O4S2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 2-(2-methoxyethylsulfanyl)-N-(4-piperidin-1-ylsulfonylphenyl)benzamide |
| SMILES | COCCSc1ccccc1C(=O)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H26N2O4S2/c1-27-15-16-28-20-8-4-3-7-19(20)21(24)22-17-9-11-18(12-10-17)29(25,26)23-13-5-2-6-14-23/h3-4,7-12H,2,5-6,13-16H2,1H3,(H,22,24) |
| InChIKey | MHSCPJHEZZQALR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|