About 1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine
1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine (PubChem CID 3158580) has the molecular formula C10H15ClN2
and a molecular weight of 198.70 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine |
| PubChem CID | 3158580 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine |
| SMILES | CN(C)C(CN)c1ccccc1Cl |
| InChI | InChI=1S/C10H15ClN2/c1-13(2)10(7-12)8-5-3-4-6-9(8)11/h3-6,10H,7,12H2,1-2H3 |
| InChIKey | JXJCCQYPULQIKT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine?
The IUPAC name of 1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine (CID 3158580) is 1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine.
What is the SMILES notation for 1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine?
The canonical SMILES for 1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine is CN(C)C(CN)c1ccccc1Cl.
What is the InChIKey of 1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine?
The InChIKey is JXJCCQYPULQIKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClN2/c1-13(2)10(7-12)8-5-3-4-6-9(8)11/h3-6,10H,7,12H2,1-2H3.
What are the key properties of 1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine?
1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine has a molecular weight of 198.70 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorophenyl)-N,N-dimethylethane-1,2-diamine is sourced from PubChem (CID 3158580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).