C22H25N3O3 — CID 3158725
2,7,9-trimethyl-5-(2,4,5-trimethoxyphenyl)-5,6-dihydropyrazolo[1,5-c]quinazoline (PubChem CID 3158725) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2,7,9-trimethyl-5-(2,4,5-trimethoxyphenyl)-5,6-dihydropyrazolo[1,5-c]quinazoline.
| Compound Name | 2,7,9-trimethyl-5-(2,4,5-trimethoxyphenyl)-5,6-dihydropyrazolo[1,5-c]quinazoline |
|---|---|
| PubChem CID | 3158725 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2,7,9-trimethyl-5-(2,4,5-trimethoxyphenyl)-5,6-dihydropyrazolo[1,5-c]quinazoline |
| SMILES | COc1cc(OC)c(C2Nc3c(C)cc(C)cc3-c3cc(C)nn32)cc1OC |
| InChI | InChI=1S/C22H25N3O3/c1-12-7-13(2)21-15(8-12)17-9-14(3)24-25(17)22(23-21)16-10-19(27-5)20(28-6)11-18(16)26-4/h7-11,22-23H,1-6H3 |
| InChIKey | NKUIRPPKUVSZMT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |