About 2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetonitrile
2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetonitrile (PubChem CID 3158768) has the molecular formula C15H22N6O
and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetonitrile.
Molecular Properties
| Compound Name | 2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetonitrile |
| PubChem CID | 3158768 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetonitrile |
| SMILES | N#CCOc1nc(N2CCCCC2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C15H22N6O/c16-7-12-22-15-18-13(20-8-3-1-4-9-20)17-14(19-15)21-10-5-2-6-11-21/h1-6,8-12H2 |
| InChIKey | GOTLTGMWRSQGGQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 78.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetonitrile?
The IUPAC name of 2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetonitrile (CID 3158768) is 2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetonitrile.
What is the SMILES notation for 2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetonitrile?
The canonical SMILES for 2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetonitrile is N#CCOc1nc(N2CCCCC2)nc(N2CCCCC2)n1.
What is the InChIKey of 2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetonitrile?
The InChIKey is GOTLTGMWRSQGGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N6O/c16-7-12-22-15-18-13(20-8-3-1-4-9-20)17-14(19-15)21-10-5-2-6-11-21/h1-6,8-12H2.
What are the key properties of 2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetonitrile?
2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetonitrile has a molecular weight of 302.38 g/mol, XLogP of 1.75, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetonitrile is sourced from PubChem (CID 3158768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).