C15H24N6O2 — CID 3159065
8-(4-ethylpiperazin-1-yl)-3-methyl-7-propan-2-ylpurine-2,6-dione (PubChem CID 3159065) has the molecular formula C15H24N6O2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 8-(4-ethylpiperazin-1-yl)-3-methyl-7-propan-2-ylpurine-2,6-dione.
| Compound Name | 8-(4-ethylpiperazin-1-yl)-3-methyl-7-propan-2-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 3159065 |
| Molecular Formula | C15H24N6O2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 8-(4-ethylpiperazin-1-yl)-3-methyl-7-propan-2-ylpurine-2,6-dione |
| SMILES | CCN1CCN(c2nc3c(c(=O)[nH]c(=O)n3C)n2C(C)C)CC1 |
| InChI | InChI=1S/C15H24N6O2/c1-5-19-6-8-20(9-7-19)14-16-12-11(21(14)10(2)3)13(22)17-15(23)18(12)4/h10H,5-9H2,1-4H3,(H,17,22,23) |
| InChIKey | KOUZJQSLZYCGNY-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |