About propan-2-yl 2-amino-3-cyano-1',2'-dimethyl-5'-oxospiro[chromene-4,4'-pyrrole]-3'-carboxylate
propan-2-yl 2-amino-3-cyano-1',2'-dimethyl-5'-oxospiro[chromene-4,4'-pyrrole]-3'-carboxylate (PubChem CID 3159133) has the molecular formula C19H19N3O4
and a molecular weight of 353.38 g/mol. Its IUPAC name is propan-2-yl 2-amino-3-cyano-1',2'-dimethyl-5'-oxospiro[chromene-4,4'-pyrrole]-3'-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 2-amino-3-cyano-1',2'-dimethyl-5'-oxospiro[chromene-4,4'-pyrrole]-3'-carboxylate |
| PubChem CID | 3159133 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | propan-2-yl 2-amino-3-cyano-1',2'-dimethyl-5'-oxospiro[chromene-4,4'-pyrrole]-3'-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C2(C(=O)N1C)C(C#N)=C(N)Oc1ccccc12 |
| InChI | InChI=1S/C19H19N3O4/c1-10(2)25-17(23)15-11(3)22(4)18(24)19(15)12-7-5-6-8-14(12)26-16(21)13(19)9-20/h5-8,10H,21H2,1-4H3 |
| InChIKey | KXDRBKHSFDIABR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze propan-2-yl 2-amino-3-cyano-1',2'-dimethyl-5'-oxospiro[chromene-4,4'-pyrrole]-3'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-amino-3-cyano-1',2'-dimethyl-5'-oxospiro[chromene-4,4'-pyrrole]-3'-carboxylate?
The IUPAC name of propan-2-yl 2-amino-3-cyano-1',2'-dimethyl-5'-oxospiro[chromene-4,4'-pyrrole]-3'-carboxylate (CID 3159133) is propan-2-yl 2-amino-3-cyano-1',2'-dimethyl-5'-oxospiro[chromene-4,4'-pyrrole]-3'-carboxylate.
What is the SMILES notation for propan-2-yl 2-amino-3-cyano-1',2'-dimethyl-5'-oxospiro[chromene-4,4'-pyrrole]-3'-carboxylate?
The canonical SMILES for propan-2-yl 2-amino-3-cyano-1',2'-dimethyl-5'-oxospiro[chromene-4,4'-pyrrole]-3'-carboxylate is CC1=C(C(=O)OC(C)C)C2(C(=O)N1C)C(C#N)=C(N)Oc1ccccc12.
What is the InChIKey of propan-2-yl 2-amino-3-cyano-1',2'-dimethyl-5'-oxospiro[chromene-4,4'-pyrrole]-3'-carboxylate?
The InChIKey is KXDRBKHSFDIABR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O4/c1-10(2)25-17(23)15-11(3)22(4)18(24)19(15)12-7-5-6-8-14(12)26-16(21)13(19)9-20/h5-8,10H,21H2,1-4H3.
What are the key properties of propan-2-yl 2-amino-3-cyano-1',2'-dimethyl-5'-oxospiro[chromene-4,4'-pyrrole]-3'-carboxylate?
propan-2-yl 2-amino-3-cyano-1',2'-dimethyl-5'-oxospiro[chromene-4,4'-pyrrole]-3'-carboxylate has a molecular weight of 353.38 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-amino-3-cyano-1',2'-dimethyl-5'-oxospiro[chromene-4,4'-pyrrole]-3'-carboxylate is sourced from PubChem (CID 3159133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).