3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid

C12H12N2O3 — CID 3159247

IUPAC3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid
SMILESCc1cccc(-c2noc(CCC(=O)O)n2)c1
InChIInChI=1S/C12H12N2O3/c1-8-3-2-4-9(7-8)12-13-10(17-14-12)5-6-11(15)16/h2-4,7H,5-6H2,1H3,(H,15,16)
InChIKeyXODDCJFEBMABKW-UHFFFAOYSA-N
MW232.24 g/mol
LogP2.06
Rot. Bonds4

About 3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid

3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid (PubChem CID 3159247) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid.

Molecular Properties

Compound Name3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid
PubChem CID3159247
Molecular FormulaC12H12N2O3
Molecular Weight232.24 g/mol
Exact Mass232.08
IUPAC Name3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid
SMILESCc1cccc(-c2noc(CCC(=O)O)n2)c1
InChIInChI=1S/C12H12N2O3/c1-8-3-2-4-9(7-8)12-13-10(17-14-12)5-6-11(15)16/h2-4,7H,5-6H2,1H3,(H,15,16)
InChIKeyXODDCJFEBMABKW-UHFFFAOYSA-N
XLogP2.06
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.24
LogP ≤ 52.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid?
The IUPAC name of 3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid (CID 3159247) is 3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid.
What is the SMILES notation for 3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid?
The canonical SMILES for 3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid is Cc1cccc(-c2noc(CCC(=O)O)n2)c1.
What is the InChIKey of 3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid?
The InChIKey is XODDCJFEBMABKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3/c1-8-3-2-4-9(7-8)12-13-10(17-14-12)5-6-11(15)16/h2-4,7H,5-6H2,1H3,(H,15,16).
What are the key properties of 3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid?
3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid has a molecular weight of 232.24 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid is sourced from PubChem (CID 3159247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).