C23H34N2O6 — CID 3159365
4,7,7-trimethyl-3-oxo-N-[3-[[(1R,4S)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl]amino]propyl]-2-oxabicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 3159365) has the molecular formula C23H34N2O6 and a molecular weight of 434.53 g/mol. Its IUPAC name is 4,7,7-trimethyl-3-oxo-N-[3-[[(1R,4S)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl]amino]propyl]-2-oxabicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | 4,7,7-trimethyl-3-oxo-N-[3-[[(1R,4S)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl]amino]propyl]-2-oxabicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 3159365 |
| Molecular Formula | C23H34N2O6 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 4,7,7-trimethyl-3-oxo-N-[3-[[(1R,4S)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl]amino]propyl]-2-oxabicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC12CCC(C(=O)NCCCNC(=O)[C@]34CC[C@](C)(C(=O)O3)C4(C)C)(OC1=O)C2(C)C |
| InChI | InChI=1S/C23H34N2O6/c1-18(2)20(5)8-10-22(18,30-16(20)28)14(26)24-12-7-13-25-15(27)23-11-9-21(6,17(29)31-23)19(23,3)4/h7-13H2,1-6H3,(H,24,26)(H,25,27)/t20-,21?,22+,23?/m1/s1 |
| InChIKey | XGRKUKXYQLTUHB-NHIVGREZSA-N |
| XLogP | 1.85 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|