C18H12Cl2N6OS — CID 3159443
3-(benzimidazol-1-ylmethyl)-6-[(2,4-dichlorophenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 3159443) has the molecular formula C18H12Cl2N6OS and a molecular weight of 431.31 g/mol. Its IUPAC name is 3-(benzimidazol-1-ylmethyl)-6-[(2,4-dichlorophenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-(benzimidazol-1-ylmethyl)-6-[(2,4-dichlorophenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 3159443 |
| Molecular Formula | C18H12Cl2N6OS |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 3-(benzimidazol-1-ylmethyl)-6-[(2,4-dichlorophenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Clc1ccc(OCc2nn3c(Cn4cnc5ccccc54)nnc3s2)c(Cl)c1 |
| InChI | InChI=1S/C18H12Cl2N6OS/c19-11-5-6-15(12(20)7-11)27-9-17-24-26-16(22-23-18(26)28-17)8-25-10-21-13-3-1-2-4-14(13)25/h1-7,10H,8-9H2 |
| InChIKey | JYXDKVKLEHJIAW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |