About 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetic acid
2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetic acid (PubChem CID 3159575) has the molecular formula C6H8N2O4S2
and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetic acid |
| PubChem CID | 3159575 |
| Molecular Formula | C6H8N2O4S2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CS(=O)(=O)Nc1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C6H8N2O4S2/c1-14(11,12)8-6-7-4(3-13-6)2-5(9)10/h3H,2H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | FOYGOEJLNFZKGH-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetic acid (CID 3159575) is 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetic acid is CS(=O)(=O)Nc1nc(CC(=O)O)cs1.
What is the InChIKey of 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is FOYGOEJLNFZKGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O4S2/c1-14(11,12)8-6-7-4(3-13-6)2-5(9)10/h3H,2H2,1H3,(H,7,8)(H,9,10).
What are the key properties of 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetic acid?
2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 236.27 g/mol, XLogP of 0.14, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 3159575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).