About N,N-diethyl-1-(furan-2-yl)ethane-1,2-diamine
N,N-diethyl-1-(furan-2-yl)ethane-1,2-diamine (PubChem CID 3159593) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is N,N-diethyl-1-(furan-2-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N,N-diethyl-1-(furan-2-yl)ethane-1,2-diamine |
| PubChem CID | 3159593 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | N,N-diethyl-1-(furan-2-yl)ethane-1,2-diamine |
| SMILES | CCN(CC)C(CN)c1ccco1 |
| InChI | InChI=1S/C10H18N2O/c1-3-12(4-2)9(8-11)10-6-5-7-13-10/h5-7,9H,3-4,8,11H2,1-2H3 |
| InChIKey | XIBTZZUXZNNSTP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethyl-1-(furan-2-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-1-(furan-2-yl)ethane-1,2-diamine?
The IUPAC name of N,N-diethyl-1-(furan-2-yl)ethane-1,2-diamine (CID 3159593) is N,N-diethyl-1-(furan-2-yl)ethane-1,2-diamine.
What is the SMILES notation for N,N-diethyl-1-(furan-2-yl)ethane-1,2-diamine?
The canonical SMILES for N,N-diethyl-1-(furan-2-yl)ethane-1,2-diamine is CCN(CC)C(CN)c1ccco1.
What is the InChIKey of N,N-diethyl-1-(furan-2-yl)ethane-1,2-diamine?
The InChIKey is XIBTZZUXZNNSTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c1-3-12(4-2)9(8-11)10-6-5-7-13-10/h5-7,9H,3-4,8,11H2,1-2H3.
What are the key properties of N,N-diethyl-1-(furan-2-yl)ethane-1,2-diamine?
N,N-diethyl-1-(furan-2-yl)ethane-1,2-diamine has a molecular weight of 182.27 g/mol, XLogP of 1.62, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-1-(furan-2-yl)ethane-1,2-diamine is sourced from PubChem (CID 3159593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).