About 2-pyridin-3-yloxyacetic acid
2-pyridin-3-yloxyacetic acid (PubChem CID 3159630) has the molecular formula C7H7NO3
and a molecular weight of 153.14 g/mol. Its IUPAC name is 2-pyridin-3-yloxyacetic acid.
Molecular Properties
| Compound Name | 2-pyridin-3-yloxyacetic acid |
| PubChem CID | 3159630 |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 2-pyridin-3-yloxyacetic acid |
| SMILES | O=C(O)COc1cccnc1 |
| InChI | InChI=1S/C7H7NO3/c9-7(10)5-11-6-2-1-3-8-4-6/h1-4H,5H2,(H,9,10) |
| InChIKey | MBEPWLCDXKKANL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyridin-3-yloxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-3-yloxyacetic acid?
The IUPAC name of 2-pyridin-3-yloxyacetic acid (CID 3159630) is 2-pyridin-3-yloxyacetic acid.
What is the SMILES notation for 2-pyridin-3-yloxyacetic acid?
The canonical SMILES for 2-pyridin-3-yloxyacetic acid is O=C(O)COc1cccnc1.
What is the InChIKey of 2-pyridin-3-yloxyacetic acid?
The InChIKey is MBEPWLCDXKKANL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3/c9-7(10)5-11-6-2-1-3-8-4-6/h1-4H,5H2,(H,9,10).
What are the key properties of 2-pyridin-3-yloxyacetic acid?
2-pyridin-3-yloxyacetic acid has a molecular weight of 153.14 g/mol, XLogP of 0.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-yloxyacetic acid is sourced from PubChem (CID 3159630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).