C9H7N3O2 — CID 3159715
3-(pyridin-3-yl)-1H-pyrazole-5-carboxylic acid (PubChem CID 3159715) has the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. Its IUPAC name is 3-pyridin-3-yl-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(pyridin-3-yl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 3159715 |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 3-pyridin-3-yl-1H-pyrazole-5-carboxylic acid |
| SMILES | C1=CC(=CN=C1)C2=NNC(=C2)C(=O)O |
| InChI | InChI=1S/C9H7N3O2/c13-9(14)8-4-7(11-12-8)6-2-1-3-10-5-6/h1-5H,(H,11,12)(H,13,14) |
| InChIKey | VZCDZCUPZRFWAW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | 222 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |