5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid

C11H12N2O3 — CID 3160219

IUPAC5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid
SMILESCc1n[nH]c(C)c1Cc1ccc(C(=O)O)o1
InChIInChI=1S/C11H12N2O3/c1-6-9(7(2)13-12-6)5-8-3-4-10(16-8)11(14)15/h3-4H,5H2,1-2H3,(H,12,13)(H,14,15)
InChIKeyNPBZTOKSEXKKAG-UHFFFAOYSA-N
MW220.23 g/mol
LogP1.91
Rot. Bonds3

About 5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid

5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid (PubChem CID 3160219) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid.

Molecular Properties

Compound Name5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid
PubChem CID3160219
Molecular FormulaC11H12N2O3
Molecular Weight220.23 g/mol
Exact Mass220.08
IUPAC Name5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid
SMILESCc1n[nH]c(C)c1Cc1ccc(C(=O)O)o1
InChIInChI=1S/C11H12N2O3/c1-6-9(7(2)13-12-6)5-8-3-4-10(16-8)11(14)15/h3-4H,5H2,1-2H3,(H,12,13)(H,14,15)
InChIKeyNPBZTOKSEXKKAG-UHFFFAOYSA-N
XLogP1.91
TPSA79.12 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.23
LogP ≤ 51.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid?
The IUPAC name of 5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid (CID 3160219) is 5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid.
What is the SMILES notation for 5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid?
The canonical SMILES for 5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid is Cc1n[nH]c(C)c1Cc1ccc(C(=O)O)o1.
What is the InChIKey of 5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid?
The InChIKey is NPBZTOKSEXKKAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c1-6-9(7(2)13-12-6)5-8-3-4-10(16-8)11(14)15/h3-4H,5H2,1-2H3,(H,12,13)(H,14,15).
What are the key properties of 5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid?
5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid has a molecular weight of 220.23 g/mol, XLogP of 1.91, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid is sourced from PubChem (CID 3160219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).