About 2-[(2-amino-1,3-benzothiazole-6-carbonyl)amino]ethyl cyclohexanecarboxylate
2-[(2-amino-1,3-benzothiazole-6-carbonyl)amino]ethyl cyclohexanecarboxylate (PubChem CID 3160408) has the molecular formula C17H21N3O3S
and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-[(2-amino-1,3-benzothiazole-6-carbonyl)amino]ethyl cyclohexanecarboxylate.
Molecular Properties
| Compound Name | 2-[(2-amino-1,3-benzothiazole-6-carbonyl)amino]ethyl cyclohexanecarboxylate |
| PubChem CID | 3160408 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-[(2-amino-1,3-benzothiazole-6-carbonyl)amino]ethyl cyclohexanecarboxylate |
| SMILES | Nc1nc2ccc(C(=O)NCCOC(=O)C3CCCCC3)cc2s1 |
| InChI | InChI=1S/C17H21N3O3S/c18-17-20-13-7-6-12(10-14(13)24-17)15(21)19-8-9-23-16(22)11-4-2-1-3-5-11/h6-7,10-11H,1-5,8-9H2,(H2,18,20)(H,19,21) |
| InChIKey | NHOJPYNZTXRVNF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-amino-1,3-benzothiazole-6-carbonyl)amino]ethyl cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-amino-1,3-benzothiazole-6-carbonyl)amino]ethyl cyclohexanecarboxylate?
The IUPAC name of 2-[(2-amino-1,3-benzothiazole-6-carbonyl)amino]ethyl cyclohexanecarboxylate (CID 3160408) is 2-[(2-amino-1,3-benzothiazole-6-carbonyl)amino]ethyl cyclohexanecarboxylate.
What is the SMILES notation for 2-[(2-amino-1,3-benzothiazole-6-carbonyl)amino]ethyl cyclohexanecarboxylate?
The canonical SMILES for 2-[(2-amino-1,3-benzothiazole-6-carbonyl)amino]ethyl cyclohexanecarboxylate is Nc1nc2ccc(C(=O)NCCOC(=O)C3CCCCC3)cc2s1.
What is the InChIKey of 2-[(2-amino-1,3-benzothiazole-6-carbonyl)amino]ethyl cyclohexanecarboxylate?
The InChIKey is NHOJPYNZTXRVNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O3S/c18-17-20-13-7-6-12(10-14(13)24-17)15(21)19-8-9-23-16(22)11-4-2-1-3-5-11/h6-7,10-11H,1-5,8-9H2,(H2,18,20)(H,19,21).
What are the key properties of 2-[(2-amino-1,3-benzothiazole-6-carbonyl)amino]ethyl cyclohexanecarboxylate?
2-[(2-amino-1,3-benzothiazole-6-carbonyl)amino]ethyl cyclohexanecarboxylate has a molecular weight of 347.44 g/mol, XLogP of 2.73, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-amino-1,3-benzothiazole-6-carbonyl)amino]ethyl cyclohexanecarboxylate is sourced from PubChem (CID 3160408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).