C21H32N2O4 — CID 3160476
1-[(4-ethoxy-3-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)piperidine-4-carboxamide (PubChem CID 3160476) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-[(4-ethoxy-3-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-[(4-ethoxy-3-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3160476 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 1-[(4-ethoxy-3-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)piperidine-4-carboxamide |
| SMILES | CCOc1ccc(CN2CCC(C(=O)NCC3CCCO3)CC2)cc1OC |
| InChI | InChI=1S/C21H32N2O4/c1-3-26-19-7-6-16(13-20(19)25-2)15-23-10-8-17(9-11-23)21(24)22-14-18-5-4-12-27-18/h6-7,13,17-18H,3-5,8-12,14-15H2,1-2H3,(H,22,24) |
| InChIKey | ZCMVXXHRJURGKI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |