C20H21N5O4 — CID 3160947
N-(2,5-dimethoxyphenyl)-5-methyl-7-(5-methylfuran-2-yl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 3160947) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-5-methyl-7-(5-methylfuran-2-yl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-5-methyl-7-(5-methylfuran-2-yl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 3160947 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-5-methyl-7-(5-methylfuran-2-yl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C2=C(C)Nc3ncnn3C2c2ccc(C)o2)c1 |
| InChI | InChI=1S/C20H21N5O4/c1-11-5-7-16(29-11)18-17(12(2)23-20-21-10-22-25(18)20)19(26)24-14-9-13(27-3)6-8-15(14)28-4/h5-10,18H,1-4H3,(H,24,26)(H,21,22,23) |
| InChIKey | ITXRPDXKROLIHF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |