C8H14N4 — CID 3162005
5-cyclohexyl-1H-1,2,4-triazol-3-amine (PubChem CID 3162005) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 5-cyclohexyl-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-cyclohexyl-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 3162005 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 5-cyclohexyl-1H-1,2,4-triazol-3-amine |
| SMILES | Nc1n[nH]c(C2CCCCC2)n1 |
| InChI | InChI=1S/C8H14N4/c9-8-10-7(11-12-8)6-4-2-1-3-5-6/h6H,1-5H2,(H3,9,10,11,12) |
| InChIKey | MHKYLXXPZPFWRK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |