C23H27N5O3 — CID 3162243
N-cyclopentyl-13-methyl-2-oxo-6-(oxolan-2-ylmethylamino)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide (PubChem CID 3162243) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-cyclopentyl-13-methyl-2-oxo-6-(oxolan-2-ylmethylamino)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide.
| Compound Name | N-cyclopentyl-13-methyl-2-oxo-6-(oxolan-2-ylmethylamino)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 3162243 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N-cyclopentyl-13-methyl-2-oxo-6-(oxolan-2-ylmethylamino)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide |
| SMILES | Cc1ccc2nc3nc(NCC4CCCO4)c(C(=O)NC4CCCC4)cc3c(=O)n2c1 |
| InChI | InChI=1S/C23H27N5O3/c1-14-8-9-19-26-21-18(23(30)28(19)13-14)11-17(22(29)25-15-5-2-3-6-15)20(27-21)24-12-16-7-4-10-31-16/h8-9,11,13,15-16H,2-7,10,12H2,1H3,(H,24,27)(H,25,29) |
| InChIKey | OELHHNUKKORPEZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|