C19H19NO5 — CID 3162323
9-(3-ethoxy-4-hydroxyphenyl)-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one (PubChem CID 3162323) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is 9-(3-ethoxy-4-hydroxyphenyl)-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one.
| Compound Name | 9-(3-ethoxy-4-hydroxyphenyl)-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one |
|---|---|
| PubChem CID | 3162323 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 9-(3-ethoxy-4-hydroxyphenyl)-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one |
| SMILES | CCOc1cc(C2CC(=O)Nc3cc4c(cc32)OCCO4)ccc1O |
| InChI | InChI=1S/C19H19NO5/c1-2-23-16-7-11(3-4-15(16)21)12-9-19(22)20-14-10-18-17(8-13(12)14)24-5-6-25-18/h3-4,7-8,10,12,21H,2,5-6,9H2,1H3,(H,20,22) |
| InChIKey | MYJYKVZBANBWGW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |