C17H19NO3 — CID 3162355
4-(2-ethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 3162355) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 4-(2-ethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 4-(2-ethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 3162355 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 4-(2-ethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | CCOc1ccccc1C1CC(=O)NC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C17H19NO3/c1-2-21-15-9-4-3-6-11(15)12-10-16(20)18-13-7-5-8-14(19)17(12)13/h3-4,6,9,12H,2,5,7-8,10H2,1H3,(H,18,20) |
| InChIKey | HBTGOSIMNDYJOC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |