C17H17NO4 — CID 3162382
methyl 4-(2,5-dioxo-1,3,4,6,7,8-hexahydroquinolin-4-yl)benzoate (PubChem CID 3162382) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is methyl 4-(2,5-dioxo-1,3,4,6,7,8-hexahydroquinolin-4-yl)benzoate.
| Compound Name | methyl 4-(2,5-dioxo-1,3,4,6,7,8-hexahydroquinolin-4-yl)benzoate |
|---|---|
| PubChem CID | 3162382 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | methyl 4-(2,5-dioxo-1,3,4,6,7,8-hexahydroquinolin-4-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2CC(=O)NC3=C2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C17H17NO4/c1-22-17(21)11-7-5-10(6-8-11)12-9-15(20)18-13-3-2-4-14(19)16(12)13/h5-8,12H,2-4,9H2,1H3,(H,18,20) |
| InChIKey | XVGGOZBYIJWHMU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |