C17H19N3O5 — CID 3162458
5-(2,3-dimethoxyphenyl)-1,3-dimethyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 3162458) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is 5-(2,3-dimethoxyphenyl)-1,3-dimethyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-(2,3-dimethoxyphenyl)-1,3-dimethyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 3162458 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 5-(2,3-dimethoxyphenyl)-1,3-dimethyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | COc1cccc(C2CC(=O)Nc3c2c(=O)n(C)c(=O)n3C)c1OC |
| InChI | InChI=1S/C17H19N3O5/c1-19-15-13(16(22)20(2)17(19)23)10(8-12(21)18-15)9-6-5-7-11(24-3)14(9)25-4/h5-7,10H,8H2,1-4H3,(H,18,21) |
| InChIKey | UJXMRHFWCWLQJA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |