C17H17N5O2 — CID 3162690
6-ethyl-2,4-dimethyl-7-phenylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 3162690) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 6-ethyl-2,4-dimethyl-7-phenylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-ethyl-2,4-dimethyl-7-phenylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 3162690 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 6-ethyl-2,4-dimethyl-7-phenylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | CCn1c(-c2ccccc2)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 |
| InChI | InChI=1S/C17H17N5O2/c1-4-21-12(11-8-6-5-7-9-11)10-22-13-14(18-16(21)22)19(2)17(24)20(3)15(13)23/h5-10H,4H2,1-3H3 |
| InChIKey | CXMSFDSUAARCMU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |