About 3-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)propanamide
3-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 3163449) has the molecular formula C12H12N2O3S2
and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)propanamide.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)propanamide |
| PubChem CID | 3163449 |
| Molecular Formula | C12H12N2O3S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccccc1)Nc1nccs1 |
| InChI | InChI=1S/C12H12N2O3S2/c15-11(14-12-13-7-8-18-12)6-9-19(16,17)10-4-2-1-3-5-10/h1-5,7-8H,6,9H2,(H,13,14,15) |
| InChIKey | QQRMMXXCQWHJEQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)propanamide?
The IUPAC name of 3-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)propanamide (CID 3163449) is 3-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)propanamide.
What is the SMILES notation for 3-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)propanamide?
The canonical SMILES for 3-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)propanamide is O=C(CCS(=O)(=O)c1ccccc1)Nc1nccs1.
What is the InChIKey of 3-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)propanamide?
The InChIKey is QQRMMXXCQWHJEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3S2/c15-11(14-12-13-7-8-18-12)6-9-19(16,17)10-4-2-1-3-5-10/h1-5,7-8H,6,9H2,(H,13,14,15).
What are the key properties of 3-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)propanamide?
3-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)propanamide has a molecular weight of 296.37 g/mol, XLogP of 1.95, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)propanamide is sourced from PubChem (CID 3163449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).