C16H9ClN4O2S — CID 3163897
6-(1,3-benzodioxol-5-yl)-3-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 3163897) has the molecular formula C16H9ClN4O2S and a molecular weight of 356.79 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-3-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-3-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 3163897 |
| Molecular Formula | C16H9ClN4O2S |
| Molecular Weight | 356.79 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-3-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Clc1ccc(-c2nnc3sc(-c4ccc5c(c4)OCO5)nn23)cc1 |
| InChI | InChI=1S/C16H9ClN4O2S/c17-11-4-1-9(2-5-11)14-18-19-16-21(14)20-15(24-16)10-3-6-12-13(7-10)23-8-22-12/h1-7H,8H2 |
| InChIKey | LBXGAEMFPTUXKC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |