C19H22N2O2S — CID 3164028
2-[[5-(1-adamantyl)-1,3-benzoxazol-2-yl]sulfanyl]acetamide (PubChem CID 3164028) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is 2-[[5-(1-adamantyl)-1,3-benzoxazol-2-yl]sulfanyl]acetamide.
| Compound Name | 2-[[5-(1-adamantyl)-1,3-benzoxazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3164028 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2-[[5-(1-adamantyl)-1,3-benzoxazol-2-yl]sulfanyl]acetamide |
| SMILES | NC(=O)CSc1nc2cc(C34CC5CC(CC(C5)C3)C4)ccc2o1 |
| InChI | InChI=1S/C19H22N2O2S/c20-17(22)10-24-18-21-15-6-14(1-2-16(15)23-18)19-7-11-3-12(8-19)5-13(4-11)9-19/h1-2,6,11-13H,3-5,7-10H2,(H2,20,22) |
| InChIKey | LZQIVYDPHFLLNQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |