3-(2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid

C11H10FNO3 — CID 3164161

IUPAC3-(2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid
SMILESCC1(C(=O)O)CC(c2ccccc2F)=NO1
InChIInChI=1S/C11H10FNO3/c1-11(10(14)15)6-9(13-16-11)7-4-2-3-5-8(7)12/h2-5H,6H2,1H3,(H,14,15)
InChIKeyFALZLFVZKITYQX-UHFFFAOYSA-N
MW223.20 g/mol
LogP1.79
Rot. Bonds2

About 3-(2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid

3-(2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid (PubChem CID 3164161) has the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid
PubChem CID3164161
Molecular FormulaC11H10FNO3
Molecular Weight223.20 g/mol
Exact Mass223.06
IUPAC Name3-(2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid
SMILESCC1(C(=O)O)CC(c2ccccc2F)=NO1
InChIInChI=1S/C11H10FNO3/c1-11(10(14)15)6-9(13-16-11)7-4-2-3-5-8(7)12/h2-5H,6H2,1H3,(H,14,15)
InChIKeyFALZLFVZKITYQX-UHFFFAOYSA-N
XLogP1.79
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.20
LogP ≤ 51.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid (CID 3164161) is 3-(2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid is CC1(C(=O)O)CC(c2ccccc2F)=NO1.
What is the InChIKey of 3-(2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid?
The InChIKey is FALZLFVZKITYQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNO3/c1-11(10(14)15)6-9(13-16-11)7-4-2-3-5-8(7)12/h2-5H,6H2,1H3,(H,14,15).
What are the key properties of 3-(2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid?
3-(2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid has a molecular weight of 223.20 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-fluorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 3164161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).