About 2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide
2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 3164323) has the molecular formula C8H11ClN2OS
and a molecular weight of 218.71 g/mol. Its IUPAC name is 2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 3164323 |
| Molecular Formula | C8H11ClN2OS |
| Molecular Weight | 218.71 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CCc1nc(NC(=O)CCl)sc1C |
| InChI | InChI=1S/C8H11ClN2OS/c1-3-6-5(2)13-8(10-6)11-7(12)4-9/h3-4H2,1-2H3,(H,10,11,12) |
| InChIKey | MSHQDDQHSXQNNX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.71 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide (CID 3164323) is 2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide is CCc1nc(NC(=O)CCl)sc1C.
What is the InChIKey of 2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is MSHQDDQHSXQNNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN2OS/c1-3-6-5(2)13-8(10-6)11-7(12)4-9/h3-4H2,1-2H3,(H,10,11,12).
What are the key properties of 2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide?
2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 218.71 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 3164323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).