C18H18ClFN2O3 — CID 31643505
3-chloro-N-[2-[2-(4-fluorophenoxy)ethyl-methylamino]-2-oxoethyl]benzamide (PubChem CID 31643505) has the molecular formula C18H18ClFN2O3 and a molecular weight of 364.80 g/mol. Its IUPAC name is 3-chloro-N-[2-[2-(4-fluorophenoxy)ethyl-methylamino]-2-oxoethyl]benzamide.
| Compound Name | 3-chloro-N-[2-[2-(4-fluorophenoxy)ethyl-methylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 31643505 |
| Molecular Formula | C18H18ClFN2O3 |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 3-chloro-N-[2-[2-(4-fluorophenoxy)ethyl-methylamino]-2-oxoethyl]benzamide |
| SMILES | CN(CCOc1ccc(F)cc1)C(=O)CNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H18ClFN2O3/c1-22(9-10-25-16-7-5-15(20)6-8-16)17(23)12-21-18(24)13-3-2-4-14(19)11-13/h2-8,11H,9-10,12H2,1H3,(H,21,24) |
| InChIKey | RDMZJSODRBHHMA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |