C12H13N3O2S — CID 3164514
N-[3-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)phenyl]acetamide (PubChem CID 3164514) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is N-[3-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)phenyl]acetamide.
| Compound Name | N-[3-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 3164514 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | N-[3-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)phenyl]acetamide |
| SMILES | CCSc1nnc(-c2cccc(NC(C)=O)c2)o1 |
| InChI | InChI=1S/C12H13N3O2S/c1-3-18-12-15-14-11(17-12)9-5-4-6-10(7-9)13-8(2)16/h4-7H,3H2,1-2H3,(H,13,16) |
| InChIKey | HXYHMWNKHTXNRE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |