C21H26N2O2S — CID 31645758
N-methyl-4-(methylsulfanylmethyl)-N-[(2-morpholin-4-ylphenyl)methyl]benzamide (PubChem CID 31645758) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is N-methyl-4-(methylsulfanylmethyl)-N-[(2-morpholin-4-ylphenyl)methyl]benzamide.
| Compound Name | N-methyl-4-(methylsulfanylmethyl)-N-[(2-morpholin-4-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 31645758 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-methyl-4-(methylsulfanylmethyl)-N-[(2-morpholin-4-ylphenyl)methyl]benzamide |
| SMILES | CSCc1ccc(C(=O)N(C)Cc2ccccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H26N2O2S/c1-22(21(24)18-9-7-17(8-10-18)16-26-2)15-19-5-3-4-6-20(19)23-11-13-25-14-12-23/h3-10H,11-16H2,1-2H3 |
| InChIKey | LVCSTVZRYWWQPG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |