C11H20N6O — CID 3165068
[3-(3-morpholin-4-ylpropyl)-2,4-dihydro-1H-1,3,5-triazin-6-yl]cyanamide (PubChem CID 3165068) has the molecular formula C11H20N6O and a molecular weight of 252.32 g/mol. Its IUPAC name is [3-(3-morpholin-4-ylpropyl)-2,4-dihydro-1H-1,3,5-triazin-6-yl]cyanamide.
| Compound Name | [3-(3-morpholin-4-ylpropyl)-2,4-dihydro-1H-1,3,5-triazin-6-yl]cyanamide |
|---|---|
| PubChem CID | 3165068 |
| Molecular Formula | C11H20N6O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | [3-(3-morpholin-4-ylpropyl)-2,4-dihydro-1H-1,3,5-triazin-6-yl]cyanamide |
| SMILES | N#CNC1=NCN(CCCN2CCOCC2)CN1 |
| InChI | InChI=1S/C11H20N6O/c12-8-13-11-14-9-17(10-15-11)3-1-2-16-4-6-18-7-5-16/h1-7,9-10H2,(H2,13,14,15) |
| InChIKey | JDRUERRVPRMKMD-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|