C27H20ClN3OS — CID 3165492
N-(4-chlorophenyl)-2-[[3-cyano-4-(4-methylphenyl)-6-phenyl-2-pyridinyl]sulfanyl]acetamide (PubChem CID 3165492) has the molecular formula C27H20ClN3OS and a molecular weight of 470.00 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[[3-cyano-4-(4-methylphenyl)-6-phenyl-2-pyridinyl]sulfanyl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[[3-cyano-4-(4-methylphenyl)-6-phenyl-2-pyridinyl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3165492 |
| Molecular Formula | C27H20ClN3OS |
| Molecular Weight | 470.00 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | N-(4-chlorophenyl)-2-[[3-cyano-4-(4-methylphenyl)-6-phenyl-2-pyridinyl]sulfanyl]acetamide |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)nc(SCC(=O)Nc3ccc(Cl)cc3)c2C#N)cc1 |
| InChI | InChI=1S/C27H20ClN3OS/c1-18-7-9-19(10-8-18)23-15-25(20-5-3-2-4-6-20)31-27(24(23)16-29)33-17-26(32)30-22-13-11-21(28)12-14-22/h2-15H,17H2,1H3,(H,30,32) |
| InChIKey | SPAYKACCVYAGEB-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.00 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |