C16H16FN3O4 — CID 31660157
[4-(4-fluoro-2-nitroanilino)piperidin-1-yl]-(furan-3-yl)methanone (PubChem CID 31660157) has the molecular formula C16H16FN3O4 and a molecular weight of 333.32 g/mol. Its IUPAC name is [4-(4-fluoro-2-nitroanilino)piperidin-1-yl]-(furan-3-yl)methanone.
| Compound Name | [4-(4-fluoro-2-nitroanilino)piperidin-1-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 31660157 |
| Molecular Formula | C16H16FN3O4 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | [4-(4-fluoro-2-nitroanilino)piperidin-1-yl]-(furan-3-yl)methanone |
| SMILES | O=C(c1ccoc1)N1CCC(Nc2ccc(F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H16FN3O4/c17-12-1-2-14(15(9-12)20(22)23)18-13-3-6-19(7-4-13)16(21)11-5-8-24-10-11/h1-2,5,8-10,13,18H,3-4,6-7H2 |
| InChIKey | LPGJFRCABJFKMI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|