About 2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxylic acid
2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 31661241) has the molecular formula C8H5N3O4
and a molecular weight of 207.15 g/mol. Its IUPAC name is 2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxylic acid.
Molecular Properties
| Compound Name | 2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxylic acid |
| PubChem CID | 31661241 |
| Molecular Formula | C8H5N3O4 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxylic acid |
| SMILES | O=C(O)c1cnc2[nH]c(=O)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C8H5N3O4/c12-6-4-1-3(7(13)14)2-9-5(4)10-8(15)11-6/h1-2H,(H,13,14)(H2,9,10,11,12,15) |
| InChIKey | PCCNUUFPHRNLKB-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 115.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxylic acid?
The IUPAC name of 2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxylic acid (CID 31661241) is 2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxylic acid.
What is the SMILES notation for 2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxylic acid?
The canonical SMILES for 2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxylic acid is O=C(O)c1cnc2[nH]c(=O)[nH]c(=O)c2c1.
What is the InChIKey of 2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxylic acid?
The InChIKey is PCCNUUFPHRNLKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O4/c12-6-4-1-3(7(13)14)2-9-5(4)10-8(15)11-6/h1-2H,(H,13,14)(H2,9,10,11,12,15).
What are the key properties of 2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxylic acid?
2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxylic acid has a molecular weight of 207.15 g/mol, XLogP of -0.69, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxylic acid is sourced from PubChem (CID 31661241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).