About N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]tetrazolo[1,5-b]pyridazin-6-amine
N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 31661549) has the molecular formula C13H11F3N6O
and a molecular weight of 324.27 g/mol. Its IUPAC name is N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]tetrazolo[1,5-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]tetrazolo[1,5-b]pyridazin-6-amine |
| PubChem CID | 31661549 |
| Molecular Formula | C13H11F3N6O |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | CN(Cc1ccccc1OC(F)(F)F)c1ccc2nnnn2n1 |
| InChI | InChI=1S/C13H11F3N6O/c1-21(12-7-6-11-17-19-20-22(11)18-12)8-9-4-2-3-5-10(9)23-13(14,15)16/h2-7H,8H2,1H3 |
| InChIKey | FKMBTZYITKPYJA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 68.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]tetrazolo[1,5-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]tetrazolo[1,5-b]pyridazin-6-amine?
The IUPAC name of N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]tetrazolo[1,5-b]pyridazin-6-amine (CID 31661549) is N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]tetrazolo[1,5-b]pyridazin-6-amine.
What is the SMILES notation for N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]tetrazolo[1,5-b]pyridazin-6-amine?
The canonical SMILES for N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]tetrazolo[1,5-b]pyridazin-6-amine is CN(Cc1ccccc1OC(F)(F)F)c1ccc2nnnn2n1.
What is the InChIKey of N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]tetrazolo[1,5-b]pyridazin-6-amine?
The InChIKey is FKMBTZYITKPYJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N6O/c1-21(12-7-6-11-17-19-20-22(11)18-12)8-9-4-2-3-5-10(9)23-13(14,15)16/h2-7H,8H2,1H3.
What are the key properties of N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]tetrazolo[1,5-b]pyridazin-6-amine?
N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]tetrazolo[1,5-b]pyridazin-6-amine has a molecular weight of 324.27 g/mol, XLogP of 2.05, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]tetrazolo[1,5-b]pyridazin-6-amine is sourced from PubChem (CID 31661549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).