About (3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[2-(2-fluorophenoxy)ethyl]piperazin-2-one
(3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[2-(2-fluorophenoxy)ethyl]piperazin-2-one (PubChem CID 31666138) has the molecular formula C23H25FN4O2
and a molecular weight of 408.48 g/mol. Its IUPAC name is (3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[2-(2-fluorophenoxy)ethyl]piperazin-2-one.
Molecular Properties
| Compound Name | (3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[2-(2-fluorophenoxy)ethyl]piperazin-2-one |
| PubChem CID | 31666138 |
| Molecular Formula | C23H25FN4O2 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[2-(2-fluorophenoxy)ethyl]piperazin-2-one |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1[C@@H]1C(=O)NCCN1CCOc1ccccc1F |
| InChI | InChI=1S/C23H25FN4O2/c1-16-21(17(2)28(26-16)18-8-4-3-5-9-18)22-23(29)25-12-13-27(22)14-15-30-20-11-7-6-10-19(20)24/h3-11,22H,12-15H2,1-2H3,(H,25,29)/t22-/m1/s1 |
| InChIKey | MCWDUBFBLAJQLH-JOCHJYFZSA-N |
| XLogP | 3.18 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[2-(2-fluorophenoxy)ethyl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[2-(2-fluorophenoxy)ethyl]piperazin-2-one?
The IUPAC name of (3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[2-(2-fluorophenoxy)ethyl]piperazin-2-one (CID 31666138) is (3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[2-(2-fluorophenoxy)ethyl]piperazin-2-one.
What is the SMILES notation for (3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[2-(2-fluorophenoxy)ethyl]piperazin-2-one?
The canonical SMILES for (3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[2-(2-fluorophenoxy)ethyl]piperazin-2-one is Cc1nn(-c2ccccc2)c(C)c1[C@@H]1C(=O)NCCN1CCOc1ccccc1F.
What is the InChIKey of (3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[2-(2-fluorophenoxy)ethyl]piperazin-2-one?
The InChIKey is MCWDUBFBLAJQLH-JOCHJYFZSA-N. The full InChI is InChI=1S/C23H25FN4O2/c1-16-21(17(2)28(26-16)18-8-4-3-5-9-18)22-23(29)25-12-13-27(22)14-15-30-20-11-7-6-10-19(20)24/h3-11,22H,12-15H2,1-2H3,(H,25,29)/t22-/m1/s1.
What are the key properties of (3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[2-(2-fluorophenoxy)ethyl]piperazin-2-one?
(3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[2-(2-fluorophenoxy)ethyl]piperazin-2-one has a molecular weight of 408.48 g/mol, XLogP of 3.18, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-4-[2-(2-fluorophenoxy)ethyl]piperazin-2-one is sourced from PubChem (CID 31666138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).