About N'-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoyl]-4-methylbenzohydrazide
N'-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoyl]-4-methylbenzohydrazide (PubChem CID 3167227) has the molecular formula C15H18N6O2S
and a molecular weight of 346.42 g/mol. Its IUPAC name is N'-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoyl]-4-methylbenzohydrazide.
Molecular Properties
| Compound Name | N'-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoyl]-4-methylbenzohydrazide |
| PubChem CID | 3167227 |
| Molecular Formula | C15H18N6O2S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N'-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoyl]-4-methylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)C(C)Sc2nc(N)cc(N)n2)cc1 |
| InChI | InChI=1S/C15H18N6O2S/c1-8-3-5-10(6-4-8)14(23)21-20-13(22)9(2)24-15-18-11(16)7-12(17)19-15/h3-7,9H,1-2H3,(H,20,22)(H,21,23)(H4,16,17,18,19) |
| InChIKey | QEGBTDBJIUFJHP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoyl]-4-methylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoyl]-4-methylbenzohydrazide?
The IUPAC name of N'-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoyl]-4-methylbenzohydrazide (CID 3167227) is N'-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoyl]-4-methylbenzohydrazide.
What is the SMILES notation for N'-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoyl]-4-methylbenzohydrazide?
The canonical SMILES for N'-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoyl]-4-methylbenzohydrazide is Cc1ccc(C(=O)NNC(=O)C(C)Sc2nc(N)cc(N)n2)cc1.
What is the InChIKey of N'-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoyl]-4-methylbenzohydrazide?
The InChIKey is QEGBTDBJIUFJHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N6O2S/c1-8-3-5-10(6-4-8)14(23)21-20-13(22)9(2)24-15-18-11(16)7-12(17)19-15/h3-7,9H,1-2H3,(H,20,22)(H,21,23)(H4,16,17,18,19).
What are the key properties of N'-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoyl]-4-methylbenzohydrazide?
N'-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoyl]-4-methylbenzohydrazide has a molecular weight of 346.42 g/mol, XLogP of 0.89, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoyl]-4-methylbenzohydrazide is sourced from PubChem (CID 3167227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).