C19H16ClN5O — CID 3167678
6-amino-4-(2-chloro-6-ethylquinolin-3-yl)-3-methyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 3167678) has the molecular formula C19H16ClN5O and a molecular weight of 365.82 g/mol. Its IUPAC name is 6-amino-4-(2-chloro-6-ethylquinolin-3-yl)-3-methyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-4-(2-chloro-6-ethylquinolin-3-yl)-3-methyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 3167678 |
| Molecular Formula | C19H16ClN5O |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 6-amino-4-(2-chloro-6-ethylquinolin-3-yl)-3-methyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | CCc1ccc2nc(Cl)c(C3C(C#N)=C(N)Oc4n[nH]c(C)c43)cc2c1 |
| InChI | InChI=1S/C19H16ClN5O/c1-3-10-4-5-14-11(6-10)7-12(17(20)23-14)16-13(8-21)18(22)26-19-15(16)9(2)24-25-19/h4-7,16H,3,22H2,1-2H3,(H,24,25) |
| InChIKey | YDGZUWRJBWCJAY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|