About methyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate
methyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate (PubChem CID 3167919) has the molecular formula C20H19N3O4
and a molecular weight of 365.39 g/mol. Its IUPAC name is methyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate |
| PubChem CID | 3167919 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | methyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate |
| SMILES | COC(=O)C1=C(C)OC(N)=C(C#N)C1c1cc2cc(C)c(C)cc2[nH]c1=O |
| InChI | InChI=1S/C20H19N3O4/c1-9-5-12-7-13(19(24)23-15(12)6-10(9)2)17-14(8-21)18(22)27-11(3)16(17)20(25)26-4/h5-7,17H,22H2,1-4H3,(H,23,24) |
| InChIKey | GDURPPYDCJFPEW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate?
The IUPAC name of methyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate (CID 3167919) is methyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate.
What is the SMILES notation for methyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate?
The canonical SMILES for methyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate is COC(=O)C1=C(C)OC(N)=C(C#N)C1c1cc2cc(C)c(C)cc2[nH]c1=O.
What is the InChIKey of methyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate?
The InChIKey is GDURPPYDCJFPEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O4/c1-9-5-12-7-13(19(24)23-15(12)6-10(9)2)17-14(8-21)18(22)27-11(3)16(17)20(25)26-4/h5-7,17H,22H2,1-4H3,(H,23,24).
What are the key properties of methyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate?
methyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate has a molecular weight of 365.39 g/mol, XLogP of 2.40, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate is sourced from PubChem (CID 3167919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).