About 2-(4,6-diaminopyrimidin-2-yl)sulfanylacetonitrile
2-(4,6-diaminopyrimidin-2-yl)sulfanylacetonitrile (PubChem CID 3167959) has the molecular formula C6H7N5S
and a molecular weight of 181.22 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanylacetonitrile.
Molecular Properties
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanylacetonitrile |
| PubChem CID | 3167959 |
| Molecular Formula | C6H7N5S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanylacetonitrile |
| SMILES | N#CCSc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C6H7N5S/c7-1-2-12-6-10-4(8)3-5(9)11-6/h3H,2H2,(H4,8,9,10,11) |
| InChIKey | VSSYCHOCFKROKH-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 101.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4,6-diaminopyrimidin-2-yl)sulfanylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-diaminopyrimidin-2-yl)sulfanylacetonitrile?
The IUPAC name of 2-(4,6-diaminopyrimidin-2-yl)sulfanylacetonitrile (CID 3167959) is 2-(4,6-diaminopyrimidin-2-yl)sulfanylacetonitrile.
What is the SMILES notation for 2-(4,6-diaminopyrimidin-2-yl)sulfanylacetonitrile?
The canonical SMILES for 2-(4,6-diaminopyrimidin-2-yl)sulfanylacetonitrile is N#CCSc1nc(N)cc(N)n1.
What is the InChIKey of 2-(4,6-diaminopyrimidin-2-yl)sulfanylacetonitrile?
The InChIKey is VSSYCHOCFKROKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5S/c7-1-2-12-6-10-4(8)3-5(9)11-6/h3H,2H2,(H4,8,9,10,11).
What are the key properties of 2-(4,6-diaminopyrimidin-2-yl)sulfanylacetonitrile?
2-(4,6-diaminopyrimidin-2-yl)sulfanylacetonitrile has a molecular weight of 181.22 g/mol, XLogP of 0.26, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-diaminopyrimidin-2-yl)sulfanylacetonitrile is sourced from PubChem (CID 3167959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).