About ethyl 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate
ethyl 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 3168202) has the molecular formula C19H19N5O3S2
and a molecular weight of 429.53 g/mol. Its IUPAC name is ethyl 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate |
| PubChem CID | 3168202 |
| Molecular Formula | C19H19N5O3S2 |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | ethyl 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)CSc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C19H19N5O3S2/c1-2-27-18(26)16-12(11-6-4-3-5-7-11)9-28-17(16)24-15(25)10-29-19-22-13(20)8-14(21)23-19/h3-9H,2,10H2,1H3,(H,24,25)(H4,20,21,22,23) |
| InChIKey | YQDQWQNGHJURHC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate?
The IUPAC name of ethyl 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate (CID 3168202) is ethyl 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate.
What is the SMILES notation for ethyl 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate?
The canonical SMILES for ethyl 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate is CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)CSc1nc(N)cc(N)n1.
What is the InChIKey of ethyl 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate?
The InChIKey is YQDQWQNGHJURHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N5O3S2/c1-2-27-18(26)16-12(11-6-4-3-5-7-11)9-28-17(16)24-15(25)10-29-19-22-13(20)8-14(21)23-19/h3-9H,2,10H2,1H3,(H,24,25)(H4,20,21,22,23).
What are the key properties of ethyl 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate?
ethyl 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate has a molecular weight of 429.53 g/mol, XLogP of 3.28, 7 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate is sourced from PubChem (CID 3168202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).