About 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide
2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide (PubChem CID 31683892) has the molecular formula C19H21N3O3S
and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide.
Molecular Properties
| Compound Name | 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide |
| PubChem CID | 31683892 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide |
| SMILES | CCn1c(=O)c2ccccc2n(CC(=O)N(C)[C@H](C)c2cccs2)c1=O |
| InChI | InChI=1S/C19H21N3O3S/c1-4-21-18(24)14-8-5-6-9-15(14)22(19(21)25)12-17(23)20(3)13(2)16-10-7-11-26-16/h5-11,13H,4,12H2,1-3H3/t13-/m1/s1 |
| InChIKey | HMEANDNLFMWXGV-CYBMUJFWSA-N |
| XLogP | 2.46 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide?
The IUPAC name of 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide (CID 31683892) is 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide.
What is the SMILES notation for 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide?
The canonical SMILES for 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide is CCn1c(=O)c2ccccc2n(CC(=O)N(C)[C@H](C)c2cccs2)c1=O.
What is the InChIKey of 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide?
The InChIKey is HMEANDNLFMWXGV-CYBMUJFWSA-N. The full InChI is InChI=1S/C19H21N3O3S/c1-4-21-18(24)14-8-5-6-9-15(14)22(19(21)25)12-17(23)20(3)13(2)16-10-7-11-26-16/h5-11,13H,4,12H2,1-3H3/t13-/m1/s1.
What are the key properties of 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide?
2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide has a molecular weight of 371.46 g/mol, XLogP of 2.46, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-methyl-N-[(1R)-1-thiophen-2-ylethyl]acetamide is sourced from PubChem (CID 31683892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).